C17H23BrFN3O4S — CID 86715844
tert-butyl N-[(3R)-3-(2-bromo-5-fluoro-4-pyridinyl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]carbamate (PubChem CID 86715844) has the molecular formula C17H23BrFN3O4S and a molecular weight of 464.36 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-(2-bromo-5-fluoro-4-pyridinyl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-3-(2-bromo-5-fluoro-4-pyridinyl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]carbamate |
|---|---|
| PubChem CID | 86715844 |
| Molecular Formula | C17H23BrFN3O4S |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | tert-butyl N-[(3R)-3-(2-bromo-5-fluoro-4-pyridinyl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@](C)(c2cc(Br)ncc2F)CS(=O)(=O)C1(C)C |
| InChI | InChI=1S/C17H23BrFN3O4S/c1-15(2,3)26-14(23)21-13-16(4,5)27(24,25)9-17(6,22-13)10-7-12(18)20-8-11(10)19/h7-8H,9H2,1-6H3,(H,21,22,23)/t17-/m0/s1 |
| InChIKey | LQUVZKKYEZWXCS-KRWDZBQOSA-N |
| XLogP | 3.33 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|