C25H35F4N3O3SSi — CID 140846086
tert-butyl N-[(1S,3R)-3-[2-fluoro-5-(2-trimethylsilylethynyl)phenyl]-3,6,6-trimethyl-1-oxo-1-(2,2,2-trifluoroethylimino)-2H-1,4-thiazin-5-yl]carbamate (PubChem CID 140846086) has the molecular formula C25H35F4N3O3SSi and a molecular weight of 561.72 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-3-[2-fluoro-5-(2-trimethylsilylethynyl)phenyl]-3,6,6-trimethyl-1-oxo-1-(2,2,2-trifluoroethylimino)-2H-1,4-thiazin-5-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-3-[2-fluoro-5-(2-trimethylsilylethynyl)phenyl]-3,6,6-trimethyl-1-oxo-1-(2,2,2-trifluoroethylimino)-2H-1,4-thiazin-5-yl]carbamate |
|---|---|
| PubChem CID | 140846086 |
| Molecular Formula | C25H35F4N3O3SSi |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | tert-butyl N-[(1S,3R)-3-[2-fluoro-5-(2-trimethylsilylethynyl)phenyl]-3,6,6-trimethyl-1-oxo-1-(2,2,2-trifluoroethylimino)-2H-1,4-thiazin-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@](C)(c2cc(C#C[Si](C)(C)C)ccc2F)C[S@@](=O)(=NCC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C25H35F4N3O3SSi/c1-22(2,3)35-21(33)31-20-23(4,5)36(34,30-15-25(27,28)29)16-24(6,32-20)18-14-17(10-11-19(18)26)12-13-37(7,8)9/h10-11,14H,15-16H2,1-9H3,(H,31,32,33)/t24-,36-/m0/s1 |
| InChIKey | ODVAHHYZZUOIJG-TVYQXRCNSA-N |
| XLogP | 6.02 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|