C15H18F4IN3OS — CID 134281749
(1S,3R)-3-(2-fluoro-5-iodophenyl)-3,6,6-trimethyl-1-oxo-1-(2,2,2-trifluoroethylimino)-2H-1,4-thiazin-5-amine (PubChem CID 134281749) has the molecular formula C15H18F4IN3OS and a molecular weight of 491.29 g/mol. Its IUPAC name is (1S,3R)-3-(2-fluoro-5-iodophenyl)-3,6,6-trimethyl-1-oxo-1-(2,2,2-trifluoroethylimino)-2H-1,4-thiazin-5-amine.
| Compound Name | (1S,3R)-3-(2-fluoro-5-iodophenyl)-3,6,6-trimethyl-1-oxo-1-(2,2,2-trifluoroethylimino)-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 134281749 |
| Molecular Formula | C15H18F4IN3OS |
| Molecular Weight | 491.29 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | (1S,3R)-3-(2-fluoro-5-iodophenyl)-3,6,6-trimethyl-1-oxo-1-(2,2,2-trifluoroethylimino)-2H-1,4-thiazin-5-amine |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(I)ccc2F)C[S@@]1(=O)=NCC(F)(F)F |
| InChI | InChI=1S/C15H18F4IN3OS/c1-13(2)12(21)23-14(3,10-6-9(20)4-5-11(10)16)8-25(13,24)22-7-15(17,18)19/h4-6H,7-8H2,1-3H3,(H2,21,23)/t14-,25-/m0/s1 |
| InChIKey | DAAODXRGICIGIS-SXBQZSJRSA-N |
| XLogP | 3.83 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|