C19H24F2N2O2S — CID 143834662
tert-butyl N-[(4aR,6R,7aR)-6-fluoro-7a-(2-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[d][1,3]thiazin-2-yl]carbamate (PubChem CID 143834662) has the molecular formula C19H24F2N2O2S and a molecular weight of 382.48 g/mol. Its IUPAC name is tert-butyl N-[(4aR,6R,7aR)-6-fluoro-7a-(2-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[d][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aR,6R,7aR)-6-fluoro-7a-(2-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[d][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 143834662 |
| Molecular Formula | C19H24F2N2O2S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | tert-butyl N-[(4aR,6R,7aR)-6-fluoro-7a-(2-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[d][1,3]thiazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@@]2(c3ccccc3F)C[C@H](F)C[C@@]2(C)CS1 |
| InChI | InChI=1S/C19H24F2N2O2S/c1-17(2,3)25-16(24)22-15-23-19(13-7-5-6-8-14(13)21)10-12(20)9-18(19,4)11-26-15/h5-8,12H,9-11H2,1-4H3,(H,22,23,24)/t12-,18+,19-/m1/s1 |
| InChIKey | XNCQECZBLFFKJA-ZUSMLRIVSA-N |
| XLogP | 4.79 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |