C23H25BrFN3O3S — CID 142421310
tert-butyl N-[(4aS,10aR)-6-bromo-10a-(2-fluorophenyl)-9-methoxy-4,4a,5,10-tetrahydropyrido[4,3-g][3,1]benzothiazin-2-yl]carbamate (PubChem CID 142421310) has the molecular formula C23H25BrFN3O3S and a molecular weight of 522.44 g/mol. Its IUPAC name is tert-butyl N-[(4aS,10aR)-6-bromo-10a-(2-fluorophenyl)-9-methoxy-4,4a,5,10-tetrahydropyrido[4,3-g][3,1]benzothiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aS,10aR)-6-bromo-10a-(2-fluorophenyl)-9-methoxy-4,4a,5,10-tetrahydropyrido[4,3-g][3,1]benzothiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 142421310 |
| Molecular Formula | C23H25BrFN3O3S |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | tert-butyl N-[(4aS,10aR)-6-bromo-10a-(2-fluorophenyl)-9-methoxy-4,4a,5,10-tetrahydropyrido[4,3-g][3,1]benzothiazin-2-yl]carbamate |
| SMILES | COc1ncc(Br)c2c1C[C@@]1(c3ccccc3F)N=C(NC(=O)OC(C)(C)C)SC[C@H]1C2 |
| InChI | InChI=1S/C23H25BrFN3O3S/c1-22(2,3)31-21(29)27-20-28-23(16-7-5-6-8-18(16)25)10-15-14(9-13(23)12-32-20)17(24)11-26-19(15)30-4/h5-8,11,13H,9-10,12H2,1-4H3,(H,27,28,29)/t13-,23-/m1/s1 |
| InChIKey | BJTNGZDEPRXBOK-JCQPUDPBSA-N |
| XLogP | 5.23 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |