C19H25FN2O3S — CID 67477674
tert-butyl N-[(6R)-8a-(2-fluorophenyl)-6-hydroxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]carbamate (PubChem CID 67477674) has the molecular formula C19H25FN2O3S and a molecular weight of 380.49 g/mol. Its IUPAC name is tert-butyl N-[(6R)-8a-(2-fluorophenyl)-6-hydroxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(6R)-8a-(2-fluorophenyl)-6-hydroxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 67477674 |
| Molecular Formula | C19H25FN2O3S |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | tert-butyl N-[(6R)-8a-(2-fluorophenyl)-6-hydroxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=NC2(c3ccccc3F)CC[C@@H](O)CC2CS1 |
| InChI | InChI=1S/C19H25FN2O3S/c1-18(2,3)25-17(24)21-16-22-19(14-6-4-5-7-15(14)20)9-8-13(23)10-12(19)11-26-16/h4-7,12-13,23H,8-11H2,1-3H3,(H,21,22,24)/t12?,13-,19?/m1/s1 |
| InChIKey | KUTJSYNKOOMNPP-FWHMADFJSA-N |
| XLogP | 3.81 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |