C20H25F2NO2S — CID 157141077
tert-butyl 2-[(4aR,6R,8aS)-6-fluoro-8a-(2-fluorophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]acetate (PubChem CID 157141077) has the molecular formula C20H25F2NO2S and a molecular weight of 381.49 g/mol. Its IUPAC name is tert-butyl 2-[(4aR,6R,8aS)-6-fluoro-8a-(2-fluorophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]acetate.
| Compound Name | tert-butyl 2-[(4aR,6R,8aS)-6-fluoro-8a-(2-fluorophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]acetate |
|---|---|
| PubChem CID | 157141077 |
| Molecular Formula | C20H25F2NO2S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | tert-butyl 2-[(4aR,6R,8aS)-6-fluoro-8a-(2-fluorophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1=N[C@@]2(c3ccccc3F)CC[C@@H](F)C[C@H]2CS1 |
| InChI | InChI=1S/C20H25F2NO2S/c1-19(2,3)25-18(24)11-17-23-20(15-6-4-5-7-16(15)22)9-8-14(21)10-13(20)12-26-17/h4-7,13-14H,8-12H2,1-3H3/t13-,14+,20-/m0/s1 |
| InChIKey | HUYCNDAMTPYCRN-MNVSYLFESA-N |
| XLogP | 5.04 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |