C27H24F2N2O2S — CID 158472088
benzyl 2-[(4aR,7aS)-7a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]acetate (PubChem CID 158472088) has the molecular formula C27H24F2N2O2S and a molecular weight of 478.56 g/mol. Its IUPAC name is benzyl 2-[(4aR,7aS)-7a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]acetate.
| Compound Name | benzyl 2-[(4aR,7aS)-7a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]acetate |
|---|---|
| PubChem CID | 158472088 |
| Molecular Formula | C27H24F2N2O2S |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | benzyl 2-[(4aR,7aS)-7a-[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]acetate |
| SMILES | O=C(CC1=N[C@@]2(c3cc(-c4cccnc4F)ccc3F)CCC[C@H]2CS1)OCc1ccccc1 |
| InChI | InChI=1S/C27H24F2N2O2S/c28-23-11-10-19(21-9-5-13-30-26(21)29)14-22(23)27-12-4-8-20(27)17-34-24(31-27)15-25(32)33-16-18-6-2-1-3-7-18/h1-3,5-7,9-11,13-14,20H,4,8,12,15-17H2/t20-,27-/m0/s1 |
| InChIKey | YANZCVHDMCOEFP-DCFHFQCYSA-N |
| XLogP | 6.30 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|