C20H26FNO3S — CID 159345024
tert-butyl 2-[(4aR,8aS)-8a-(2-fluorophenyl)-7-hydroxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]acetate (PubChem CID 159345024) has the molecular formula C20H26FNO3S and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl 2-[(4aR,8aS)-8a-(2-fluorophenyl)-7-hydroxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]acetate.
| Compound Name | tert-butyl 2-[(4aR,8aS)-8a-(2-fluorophenyl)-7-hydroxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]acetate |
|---|---|
| PubChem CID | 159345024 |
| Molecular Formula | C20H26FNO3S |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | tert-butyl 2-[(4aR,8aS)-8a-(2-fluorophenyl)-7-hydroxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1=N[C@@]2(c3ccccc3F)CC(O)CC[C@H]2CS1 |
| InChI | InChI=1S/C20H26FNO3S/c1-19(2,3)25-18(24)10-17-22-20(15-6-4-5-7-16(15)21)11-14(23)9-8-13(20)12-26-17/h4-7,13-14,23H,8-12H2,1-3H3/t13-,14?,20-/m0/s1 |
| InChIKey | OJRMIXWPFFDGAX-PAYXGYOQSA-N |
| XLogP | 4.06 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |