C18H23FN2O3S — CID 67279571
[(4aR,6S,7aS)-7a-(2-fluorophenyl)-6-hydroxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid (PubChem CID 67279571) has the molecular formula C18H23FN2O3S and a molecular weight of 366.46 g/mol. Its IUPAC name is [(4aR,6S,7aS)-7a-(2-fluorophenyl)-6-hydroxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(4aR,6S,7aS)-7a-(2-fluorophenyl)-6-hydroxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67279571 |
| Molecular Formula | C18H23FN2O3S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [(4aR,6S,7aS)-7a-(2-fluorophenyl)-6-hydroxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1=N[C@@]2(c3ccccc3F)C[C@@H](O)C[C@H]2CS1 |
| InChI | InChI=1S/C18H23FN2O3S/c1-17(2,3)21(16(23)24)15-20-18(13-6-4-5-7-14(13)19)9-12(22)8-11(18)10-25-15/h4-7,11-12,22H,8-10H2,1-3H3,(H,23,24)/t11-,12-,18-/m0/s1 |
| InChIKey | MOFAPSWURXIHCV-PZROIBLQSA-N |
| XLogP | 3.67 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |