C19H26FN3O4S — CID 67217277
[(4aS,5R,8aS)-8a-(5-amino-2-fluorophenyl)-5-methoxy-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid (PubChem CID 67217277) has the molecular formula C19H26FN3O4S and a molecular weight of 411.50 g/mol. Its IUPAC name is [(4aS,5R,8aS)-8a-(5-amino-2-fluorophenyl)-5-methoxy-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(4aS,5R,8aS)-8a-(5-amino-2-fluorophenyl)-5-methoxy-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67217277 |
| Molecular Formula | C19H26FN3O4S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [(4aS,5R,8aS)-8a-(5-amino-2-fluorophenyl)-5-methoxy-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
| SMILES | CO[C@H]1COC[C@]2(c3cc(N)ccc3F)N=C(N(C(=O)O)C(C)(C)C)SC[C@H]12 |
| InChI | InChI=1S/C19H26FN3O4S/c1-18(2,3)23(17(24)25)16-22-19(12-7-11(21)5-6-14(12)20)10-27-8-15(26-4)13(19)9-28-16/h5-7,13,15H,8-10,21H2,1-4H3,(H,24,25)/t13-,15+,19-/m1/s1 |
| InChIKey | RUYVKGRSTBLQMN-FRIZHTMISA-N |
| XLogP | 3.15 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|