C18H24FN3O3S — CID 57827157
tert-butyl N-[(4aS,8aS)-8a-(5-amino-2-fluorophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]carbamate (PubChem CID 57827157) has the molecular formula C18H24FN3O3S and a molecular weight of 381.50 g/mol. Its IUPAC name is tert-butyl N-[(4aS,8aS)-8a-(5-amino-2-fluorophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aS,8aS)-8a-(5-amino-2-fluorophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 57827157 |
| Molecular Formula | C18H24FN3O3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | tert-butyl N-[(4aS,8aS)-8a-(5-amino-2-fluorophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@]2(CCOC[C@H]2CS1)C3=C(C=CC(=C3)N)F |
| InChI | InChI=1S/C18H24FN3O3S/c1-17(2,3)25-16(23)21-15-22-18(6-7-24-9-11(18)10-26-15)13-8-12(20)4-5-14(13)19/h4-5,8,11H,6-7,9-10,20H2,1-3H3,(H,21,22,23)/t11-,18-/m0/s1 |
| InChIKey | MFRZLARMDLSETB-VOJFVSQTSA-N |
| XLogP | 2.50 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | 568 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|