C18H22FN3O4S — CID 67279316
[(4aR,7aS)-7a-(2-fluoro-5-nitrophenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid (PubChem CID 67279316) has the molecular formula C18H22FN3O4S and a molecular weight of 395.46 g/mol. Its IUPAC name is [(4aR,7aS)-7a-(2-fluoro-5-nitrophenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(4aR,7aS)-7a-(2-fluoro-5-nitrophenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67279316 |
| Molecular Formula | C18H22FN3O4S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [(4aR,7aS)-7a-(2-fluoro-5-nitrophenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1=N[C@@]2(c3cc([N+](=O)[O-])ccc3F)CCC[C@H]2CS1 |
| InChI | InChI=1S/C18H22FN3O4S/c1-17(2,3)21(16(23)24)15-20-18(8-4-5-11(18)10-27-15)13-9-12(22(25)26)6-7-14(13)19/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,23,24)/t11-,18-/m0/s1 |
| InChIKey | IEHBHXCOZQJTQC-VOJFVSQTSA-N |
| XLogP | 4.61 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|