C18H20F3N3O5S — CID 67279888
[(4aS,7aS)-4-(difluoromethyl)-7a-(2-fluoro-5-nitrophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid (PubChem CID 67279888) has the molecular formula C18H20F3N3O5S and a molecular weight of 447.44 g/mol. Its IUPAC name is [(4aS,7aS)-4-(difluoromethyl)-7a-(2-fluoro-5-nitrophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(4aS,7aS)-4-(difluoromethyl)-7a-(2-fluoro-5-nitrophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67279888 |
| Molecular Formula | C18H20F3N3O5S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | [(4aS,7aS)-4-(difluoromethyl)-7a-(2-fluoro-5-nitrophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1=N[C@@]2(c3cc([N+](=O)[O-])ccc3F)COC[C@H]2C(C(F)F)S1 |
| InChI | InChI=1S/C18H20F3N3O5S/c1-17(2,3)23(16(25)26)15-22-18(8-29-7-11(18)13(30-15)14(20)21)10-6-9(24(27)28)4-5-12(10)19/h4-6,11,13-14H,7-8H2,1-3H3,(H,25,26)/t11-,13?,18+/m0/s1 |
| InChIKey | DACSBKKQUJNAOW-BLQMHPTMSA-N |
| XLogP | 4.09 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|