C20H26N2O5S — CID 59621341
tert-butyl 2-[(4aR,7aS)-7a-(2-methoxy-5-nitrophenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]acetate (PubChem CID 59621341) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is tert-butyl 2-[(4aR,7aS)-7a-(2-methoxy-5-nitrophenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]acetate.
| Compound Name | tert-butyl 2-[(4aR,7aS)-7a-(2-methoxy-5-nitrophenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]acetate |
|---|---|
| PubChem CID | 59621341 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | tert-butyl 2-[(4aR,7aS)-7a-(2-methoxy-5-nitrophenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]acetate |
| SMILES | COc1ccc([N+](=O)[O-])cc1[C@]12CCC[C@H]1CSC(CC(=O)OC(C)(C)C)=N2 |
| InChI | InChI=1S/C20H26N2O5S/c1-19(2,3)27-18(23)11-17-21-20(9-5-6-13(20)12-28-17)15-10-14(22(24)25)7-8-16(15)26-4/h7-8,10,13H,5-6,9,11-12H2,1-4H3/t13-,20-/m0/s1 |
| InChIKey | YVWIQGGQHPUMLS-RBZFPXEDSA-N |
| XLogP | 4.48 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|