C21H22ClFN4OS — CID 87577526
N-[3-(2-amino-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-9a-yl)-4-fluorophenyl]-6-chloropyridine-2-carboxamide (PubChem CID 87577526) has the molecular formula C21H22ClFN4OS and a molecular weight of 432.95 g/mol. Its IUPAC name is N-[3-(2-amino-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-9a-yl)-4-fluorophenyl]-6-chloropyridine-2-carboxamide.
| Compound Name | N-[3-(2-amino-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-9a-yl)-4-fluorophenyl]-6-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 87577526 |
| Molecular Formula | C21H22ClFN4OS |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-[3-(2-amino-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-9a-yl)-4-fluorophenyl]-6-chloropyridine-2-carboxamide |
| SMILES | NC1=NC2(c3cc(NC(=O)c4cccc(Cl)n4)ccc3F)CCCCCC2CS1 |
| InChI | InChI=1S/C21H22ClFN4OS/c22-18-7-4-6-17(26-18)19(28)25-14-8-9-16(23)15(11-14)21-10-3-1-2-5-13(21)12-29-20(24)27-21/h4,6-9,11,13H,1-3,5,10,12H2,(H2,24,27)(H,25,28) |
| InChIKey | AQBXGIQATMXGAF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|