C15H19FN2S — CID 70259386
(9aS)-9a-(2-fluorophenyl)-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-2-amine (PubChem CID 70259386) has the molecular formula C15H19FN2S and a molecular weight of 278.40 g/mol. Its IUPAC name is (9aS)-9a-(2-fluorophenyl)-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-2-amine.
| Compound Name | (9aS)-9a-(2-fluorophenyl)-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 70259386 |
| Molecular Formula | C15H19FN2S |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (9aS)-9a-(2-fluorophenyl)-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3ccccc3F)CCCCCC2CS1 |
| InChI | InChI=1S/C15H19FN2S/c16-13-8-4-3-7-12(13)15-9-5-1-2-6-11(15)10-19-14(17)18-15/h3-4,7-8,11H,1-2,5-6,9-10H2,(H2,17,18)/t11?,15-/m0/s1 |
| InChIKey | LHIMCRQFHVHNFE-MHTVFEQDSA-N |
| XLogP | 3.66 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |