C22H24F3N5O2S — CID 118033407
N-[3-[(4aR,9aS)-2-amino-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-9a-yl]-4-fluorophenyl]-5-(1,2-difluoroethoxy)pyrazine-2-carboxamide (PubChem CID 118033407) has the molecular formula C22H24F3N5O2S and a molecular weight of 479.53 g/mol. Its IUPAC name is N-[3-[(4aR,9aS)-2-amino-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-9a-yl]-4-fluorophenyl]-5-(1,2-difluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(4aR,9aS)-2-amino-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-9a-yl]-4-fluorophenyl]-5-(1,2-difluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118033407 |
| Molecular Formula | C22H24F3N5O2S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-[3-[(4aR,9aS)-2-amino-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-9a-yl]-4-fluorophenyl]-5-(1,2-difluoroethoxy)pyrazine-2-carboxamide |
| SMILES | NC1=N[C@@]2(c3cc(NC(=O)c4cnc(OC(F)CF)cn4)ccc3F)CCCCC[C@H]2CS1 |
| InChI | InChI=1S/C22H24F3N5O2S/c23-9-18(25)32-19-11-27-17(10-28-19)20(31)29-14-5-6-16(24)15(8-14)22-7-3-1-2-4-13(22)12-33-21(26)30-22/h5-6,8,10-11,13,18H,1-4,7,9,12H2,(H2,26,30)(H,29,31)/t13-,18?,22-/m0/s1 |
| InChIKey | BIKTWQJILLCZBO-LSHSXWSESA-N |
| XLogP | 4.35 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |