C22H25F3N4O3S — CID 144942361
N-[3-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-(difluoromethoxy)pyridine-2-carboxamide;ethane (PubChem CID 144942361) has the molecular formula C22H25F3N4O3S and a molecular weight of 482.53 g/mol. Its IUPAC name is N-[3-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-(difluoromethoxy)pyridine-2-carboxamide;ethane.
| Compound Name | N-[3-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-(difluoromethoxy)pyridine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 144942361 |
| Molecular Formula | C22H25F3N4O3S |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | N-[3-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-(difluoromethoxy)pyridine-2-carboxamide;ethane |
| SMILES | CC.NC1=NC2(c3cc(NC(=O)c4ccc(OC(F)F)cn4)ccc3F)COCCC2CS1 |
| InChI | InChI=1S/C20H19F3N4O3S.C2H6/c21-15-3-1-12(26-17(28)16-4-2-13(8-25-16)30-18(22)23)7-14(15)20-10-29-6-5-11(20)9-31-19(24)27-20;1-2/h1-4,7-8,11,18H,5-6,9-10H2,(H2,24,27)(H,26,28);1-2H3 |
| InChIKey | JPTBAOSKJGYAKA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |