C20H19F3N4O3S — CID 71060732
N-[3-[(4aR,8aR)-2-amino-4a,5,6,7-tetrahydro-4H-pyrano[3,2-e][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-(difluoromethoxy)pyridine-2-carboxamide (PubChem CID 71060732) has the molecular formula C20H19F3N4O3S and a molecular weight of 452.46 g/mol. Its IUPAC name is N-[3-[(4aR,8aR)-2-amino-4a,5,6,7-tetrahydro-4H-pyrano[3,2-e][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-(difluoromethoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-[(4aR,8aR)-2-amino-4a,5,6,7-tetrahydro-4H-pyrano[3,2-e][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-(difluoromethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71060732 |
| Molecular Formula | C20H19F3N4O3S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-[3-[(4aR,8aR)-2-amino-4a,5,6,7-tetrahydro-4H-pyrano[3,2-e][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-(difluoromethoxy)pyridine-2-carboxamide |
| SMILES | NC1=NC[C@H]2CCCO[C@@]2(c2cc(NC(=O)c3ccc(OC(F)F)cn3)ccc2F)S1 |
| InChI | InChI=1S/C20H19F3N4O3S/c21-15-5-3-12(27-17(28)16-6-4-13(10-25-16)30-18(22)23)8-14(15)20-11(2-1-7-29-20)9-26-19(24)31-20/h3-6,8,10-11,18H,1-2,7,9H2,(H2,24,26)(H,27,28)/t11-,20-/m1/s1 |
| InChIKey | VRKFNWWVYNERDB-BIBXISHDSA-N |
| XLogP | 3.72 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |