C19H19F2N5O3S — CID 70557280
N-[3-[(4aS,5S,7aS)-2-amino-5-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide (PubChem CID 70557280) has the molecular formula C19H19F2N5O3S and a molecular weight of 435.46 g/mol. Its IUPAC name is N-[3-[(4aS,5S,7aS)-2-amino-5-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide.
| Compound Name | N-[3-[(4aS,5S,7aS)-2-amino-5-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 70557280 |
| Molecular Formula | C19H19F2N5O3S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[3-[(4aS,5S,7aS)-2-amino-5-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide |
| SMILES | COc1cnc(C(=O)Nc2ccc(F)c([C@]34CO[C@H](CF)[C@@H]3CN=C(N)S4)c2)cn1 |
| InChI | InChI=1S/C19H19F2N5O3S/c1-28-16-8-23-14(7-24-16)17(27)26-10-2-3-13(21)11(4-10)19-9-29-15(5-20)12(19)6-25-18(22)30-19/h2-4,7-8,12,15H,5-6,9H2,1H3,(H2,22,25)(H,26,27)/t12-,15+,19+/m0/s1 |
| InChIKey | NCIOUEBPRFSXGG-IOHHAYIISA-N |
| XLogP | 2.12 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |