C22H26FN5O5S — CID 153454371
N-[3-[(3R,4aS,5R,7aS)-2-amino-3,5-dimethyl-3-methylsulfonyl-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide (PubChem CID 153454371) has the molecular formula C22H26FN5O5S and a molecular weight of 491.55 g/mol. Its IUPAC name is N-[3-[(3R,4aS,5R,7aS)-2-amino-3,5-dimethyl-3-methylsulfonyl-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide.
| Compound Name | N-[3-[(3R,4aS,5R,7aS)-2-amino-3,5-dimethyl-3-methylsulfonyl-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 153454371 |
| Molecular Formula | C22H26FN5O5S |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-[3-[(3R,4aS,5R,7aS)-2-amino-3,5-dimethyl-3-methylsulfonyl-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide |
| SMILES | COc1cnc(C(=O)Nc2ccc(F)c([C@]34CO[C@H](C)[C@H]3C[C@@](C)(S(C)(=O)=O)C(N)=N4)c2)cn1 |
| InChI | InChI=1S/C22H26FN5O5S/c1-12-15-8-21(2,34(4,30)31)20(24)28-22(15,11-33-12)14-7-13(5-6-16(14)23)27-19(29)17-9-26-18(32-3)10-25-17/h5-7,9-10,12,15H,8,11H2,1-4H3,(H2,24,28)(H,27,29)/t12-,15-,21-,22-/m1/s1 |
| InChIKey | QQCKTCXFVORBHB-MGMVOCMOSA-N |
| XLogP | 1.67 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |