C19H19FN4O2S — CID 66861397
N-[3-[(8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-4-fluorophenyl]pyridine-2-carboxamide (PubChem CID 66861397) has the molecular formula C19H19FN4O2S and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[3-[(8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-4-fluorophenyl]pyridine-2-carboxamide.
| Compound Name | N-[3-[(8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-4-fluorophenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 66861397 |
| Molecular Formula | C19H19FN4O2S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-[3-[(8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-4-fluorophenyl]pyridine-2-carboxamide |
| SMILES | NC1=N[C@@]2(c3cc(NC(=O)c4ccccn4)ccc3F)CCOCC2CS1 |
| InChI | InChI=1S/C19H19FN4O2S/c20-15-5-4-13(23-17(25)16-3-1-2-7-22-16)9-14(15)19-6-8-26-10-12(19)11-27-18(21)24-19/h1-5,7,9,12H,6,8,10-11H2,(H2,21,24)(H,23,25)/t12?,19-/m0/s1 |
| InChIKey | XOMROSUUXBRAQA-RKLCOFROSA-N |
| XLogP | 2.77 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |