C19H18ClFN4O2S — CID 66861955
N-[5-[(8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-2-fluorophenyl]-5-chloropyridine-2-carboxamide (PubChem CID 66861955) has the molecular formula C19H18ClFN4O2S and a molecular weight of 420.90 g/mol. Its IUPAC name is N-[5-[(8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-2-fluorophenyl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[5-[(8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-2-fluorophenyl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 66861955 |
| Molecular Formula | C19H18ClFN4O2S |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-[5-[(8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-2-fluorophenyl]-5-chloropyridine-2-carboxamide |
| SMILES | NC1=N[C@@]2(c3ccc(F)c(NC(=O)c4ccc(Cl)cn4)c3)CCOCC2CS1 |
| InChI | InChI=1S/C19H18ClFN4O2S/c20-13-2-4-15(23-8-13)17(26)24-16-7-11(1-3-14(16)21)19-5-6-27-9-12(19)10-28-18(22)25-19/h1-4,7-8,12H,5-6,9-10H2,(H2,22,25)(H,24,26)/t12?,19-/m1/s1 |
| InChIKey | RIRZAGZUQWZZGV-FKWGRNQDSA-N |
| XLogP | 3.42 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |