C19H19ClN4O2S — CID 66847791
N-[3-[(8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[3,4-e][1,3]thiazin-8a-yl]phenyl]-5-chloropyridine-2-carboxamide (PubChem CID 66847791) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is N-[3-[(8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[3,4-e][1,3]thiazin-8a-yl]phenyl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[3-[(8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[3,4-e][1,3]thiazin-8a-yl]phenyl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 66847791 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-[3-[(8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[3,4-e][1,3]thiazin-8a-yl]phenyl]-5-chloropyridine-2-carboxamide |
| SMILES | NC1=NCC2COCC[C@]2(c2cccc(NC(=O)c3ccc(Cl)cn3)c2)S1 |
| InChI | InChI=1S/C19H19ClN4O2S/c20-14-4-5-16(22-10-14)17(25)24-15-3-1-2-12(8-15)19-6-7-26-11-13(19)9-23-18(21)27-19/h1-5,8,10,13H,6-7,9,11H2,(H2,21,23)(H,24,25)/t13?,19-/m1/s1 |
| InChIKey | VJNLLCMXWMHEPG-GAGCMDECSA-N |
| XLogP | 3.28 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |