C14H15BrN2O3S — CID 68745783
[(8aS)-8a-(3-bromophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[3,4-e][1,3]thiazin-2-yl]carbamic acid (PubChem CID 68745783) has the molecular formula C14H15BrN2O3S and a molecular weight of 371.26 g/mol. Its IUPAC name is [(8aS)-8a-(3-bromophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[3,4-e][1,3]thiazin-2-yl]carbamic acid.
| Compound Name | [(8aS)-8a-(3-bromophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[3,4-e][1,3]thiazin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68745783 |
| Molecular Formula | C14H15BrN2O3S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | [(8aS)-8a-(3-bromophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[3,4-e][1,3]thiazin-2-yl]carbamic acid |
| SMILES | O=C(O)NC1=NCC2COCC[C@]2(c2cccc(Br)c2)S1 |
| InChI | InChI=1S/C14H15BrN2O3S/c15-11-3-1-2-9(6-11)14-4-5-20-8-10(14)7-16-12(21-14)17-13(18)19/h1-3,6,10H,4-5,7-8H2,(H,16,17)(H,18,19)/t10?,14-/m1/s1 |
| InChIKey | DLJQUSNSGCETGL-LNUXAPHWSA-N |
| XLogP | 3.05 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |