C21H23FN4O3S — CID 66847874
tert-butyl N-[7a-(4-fluoro-3-pyrimidin-5-ylphenyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-yl]carbamate (PubChem CID 66847874) has the molecular formula C21H23FN4O3S and a molecular weight of 430.51 g/mol. Its IUPAC name is tert-butyl N-[7a-(4-fluoro-3-pyrimidin-5-ylphenyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[7a-(4-fluoro-3-pyrimidin-5-ylphenyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 66847874 |
| Molecular Formula | C21H23FN4O3S |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | tert-butyl N-[7a-(4-fluoro-3-pyrimidin-5-ylphenyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=NCC2COCC2(c2ccc(F)c(-c3cncnc3)c2)S1 |
| InChI | InChI=1S/C21H23FN4O3S/c1-20(2,3)29-19(27)26-18-25-9-15-10-28-11-21(15,30-18)14-4-5-17(22)16(6-14)13-7-23-12-24-8-13/h4-8,12,15H,9-11H2,1-3H3,(H,25,26,27) |
| InChIKey | PNWWCLAYSCBLTD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |