C24H30FN3O5S — CID 129201948
tert-butyl N-[5-(2-fluorophenyl)-2-methyl-1,1-dioxo-5-(2-phenylmethoxyethyl)-6H-1,2,4-thiadiazin-3-yl]carbamate (PubChem CID 129201948) has the molecular formula C24H30FN3O5S and a molecular weight of 491.59 g/mol. Its IUPAC name is tert-butyl N-[5-(2-fluorophenyl)-2-methyl-1,1-dioxo-5-(2-phenylmethoxyethyl)-6H-1,2,4-thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-(2-fluorophenyl)-2-methyl-1,1-dioxo-5-(2-phenylmethoxyethyl)-6H-1,2,4-thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 129201948 |
| Molecular Formula | C24H30FN3O5S |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | tert-butyl N-[5-(2-fluorophenyl)-2-methyl-1,1-dioxo-5-(2-phenylmethoxyethyl)-6H-1,2,4-thiadiazin-3-yl]carbamate |
| SMILES | CN1C(NC(=O)OC(C)(C)C)=NC(CCOCc2ccccc2)(c2ccccc2F)CS1(=O)=O |
| InChI | InChI=1S/C24H30FN3O5S/c1-23(2,3)33-22(29)26-21-27-24(17-34(30,31)28(21)4,19-12-8-9-13-20(19)25)14-15-32-16-18-10-6-5-7-11-18/h5-13H,14-17H2,1-4H3,(H,26,27,29) |
| InChIKey | RXLXYQFBDMETMN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|