C24H32FN3O5S — CID 137474674
tert-butyl N-[(5S)-5-[(3E,5Z)-3-fluorohepta-1,3,5-trien-2-yl]-2-methyl-1,1-dioxo-5-(phenylmethoxymethyl)-6H-1,2,4-thiadiazin-3-yl]carbamate (PubChem CID 137474674) has the molecular formula C24H32FN3O5S and a molecular weight of 493.60 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-[(3E,5Z)-3-fluorohepta-1,3,5-trien-2-yl]-2-methyl-1,1-dioxo-5-(phenylmethoxymethyl)-6H-1,2,4-thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-[(3E,5Z)-3-fluorohepta-1,3,5-trien-2-yl]-2-methyl-1,1-dioxo-5-(phenylmethoxymethyl)-6H-1,2,4-thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 137474674 |
| Molecular Formula | C24H32FN3O5S |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | tert-butyl N-[(5S)-5-[(3E,5Z)-3-fluorohepta-1,3,5-trien-2-yl]-2-methyl-1,1-dioxo-5-(phenylmethoxymethyl)-6H-1,2,4-thiadiazin-3-yl]carbamate |
| SMILES | C=C(/C(F)=C\C=C/C)[C@]1(COCc2ccccc2)CS(=O)(=O)N(C)C(NC(=O)OC(C)(C)C)=N1 |
| InChI | InChI=1S/C24H32FN3O5S/c1-7-8-14-20(25)18(2)24(16-32-15-19-12-10-9-11-13-19)17-34(30,31)28(6)21(27-24)26-22(29)33-23(3,4)5/h7-14H,2,15-17H2,1,3-6H3,(H,26,27,29)/b8-7-,20-14+/t24-/m0/s1 |
| InChIKey | JEAAPACOPOTAIJ-HCMQSBLYSA-N |
| XLogP | 4.08 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|