C16H24FN3O3S — CID 129201941
5-(2-butoxyethyl)-5-(2-fluorophenyl)-2-methyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 129201941) has the molecular formula C16H24FN3O3S and a molecular weight of 357.45 g/mol. Its IUPAC name is 5-(2-butoxyethyl)-5-(2-fluorophenyl)-2-methyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | 5-(2-butoxyethyl)-5-(2-fluorophenyl)-2-methyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 129201941 |
| Molecular Formula | C16H24FN3O3S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 5-(2-butoxyethyl)-5-(2-fluorophenyl)-2-methyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CCCCOCCC1(c2ccccc2F)CS(=O)(=O)N(C)C(N)=N1 |
| InChI | InChI=1S/C16H24FN3O3S/c1-3-4-10-23-11-9-16(13-7-5-6-8-14(13)17)12-24(21,22)20(2)15(18)19-16/h5-8H,3-4,9-12H2,1-2H3,(H2,18,19) |
| InChIKey | UAGDJSNHBRTXIJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|