C19H26FN5O4S — CID 138722352
tert-butyl N-[5-(2-fluorophenyl)-2-methyl-1,1-dioxo-5-prop-2-enyl-6H-1,2,4-thiadiazin-3-yl]-N-(2-methylidenehydrazinyl)carbamate (PubChem CID 138722352) has the molecular formula C19H26FN5O4S and a molecular weight of 439.51 g/mol. Its IUPAC name is tert-butyl N-[5-(2-fluorophenyl)-2-methyl-1,1-dioxo-5-prop-2-enyl-6H-1,2,4-thiadiazin-3-yl]-N-(2-methylidenehydrazinyl)carbamate.
| Compound Name | tert-butyl N-[5-(2-fluorophenyl)-2-methyl-1,1-dioxo-5-prop-2-enyl-6H-1,2,4-thiadiazin-3-yl]-N-(2-methylidenehydrazinyl)carbamate |
|---|---|
| PubChem CID | 138722352 |
| Molecular Formula | C19H26FN5O4S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | tert-butyl N-[5-(2-fluorophenyl)-2-methyl-1,1-dioxo-5-prop-2-enyl-6H-1,2,4-thiadiazin-3-yl]-N-(2-methylidenehydrazinyl)carbamate |
| SMILES | C=CCC1(c2ccccc2F)CS(=O)(=O)N(C)C(N(NN=C)C(=O)OC(C)(C)C)=N1 |
| InChI | InChI=1S/C19H26FN5O4S/c1-7-12-19(14-10-8-9-11-15(14)20)13-30(27,28)24(6)16(22-19)25(23-21-5)17(26)29-18(2,3)4/h7-11,23H,1,5,12-13H2,2-4,6H3 |
| InChIKey | HUWMEPKCVJZSQQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|