C11H12F2O — CID 155941931
4-(cyclobutyloxymethyl)-1,2-difluorobenzene (PubChem CID 155941931) has the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. Its IUPAC name is 4-(cyclobutyloxymethyl)-1,2-difluorobenzene.
| Compound Name | 4-(cyclobutyloxymethyl)-1,2-difluorobenzene |
|---|---|
| PubChem CID | 155941931 |
| Molecular Formula | C11H12F2O |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4-(cyclobutyloxymethyl)-1,2-difluorobenzene |
| SMILES | Fc1ccc(COC2CCC2)cc1F |
| InChI | InChI=1S/C11H12F2O/c12-10-5-4-8(6-11(10)13)7-14-9-2-1-3-9/h4-6,9H,1-3,7H2 |
| InChIKey | DJNZPEALJSSLCS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |