C15H19FO4 — CID 107881229
2-fluoro-5-[(3-methoxycyclohexyl)oxymethyl]benzoic acid (PubChem CID 107881229) has the molecular formula C15H19FO4 and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-fluoro-5-[(3-methoxycyclohexyl)oxymethyl]benzoic acid.
| Compound Name | 2-fluoro-5-[(3-methoxycyclohexyl)oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 107881229 |
| Molecular Formula | C15H19FO4 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-fluoro-5-[(3-methoxycyclohexyl)oxymethyl]benzoic acid |
| SMILES | COC1CCCC(OCc2ccc(F)c(C(=O)O)c2)C1 |
| InChI | InChI=1S/C15H19FO4/c1-19-11-3-2-4-12(8-11)20-9-10-5-6-14(16)13(7-10)15(17)18/h5-7,11-12H,2-4,8-9H2,1H3,(H,17,18) |
| InChIKey | MEKDCOCCGBJTCY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |