C13H14FNO2 — CID 154520053
(3aR,6aS)-6a-(2-fluorophenyl)spiro[1,3,3a,6-tetrahydrofuro[3,4-c][1,2]oxazole-4,1'-cyclopropane] (PubChem CID 154520053) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is (3aR,6aS)-6a-(2-fluorophenyl)spiro[1,3,3a,6-tetrahydrofuro[3,4-c][1,2]oxazole-4,1'-cyclopropane].
| Compound Name | (3aR,6aS)-6a-(2-fluorophenyl)spiro[1,3,3a,6-tetrahydrofuro[3,4-c][1,2]oxazole-4,1'-cyclopropane] |
|---|---|
| PubChem CID | 154520053 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (3aR,6aS)-6a-(2-fluorophenyl)spiro[1,3,3a,6-tetrahydrofuro[3,4-c][1,2]oxazole-4,1'-cyclopropane] |
| SMILES | Fc1ccccc1[C@]12COC3(CC3)[C@H]1CON2 |
| InChI | InChI=1S/C13H14FNO2/c14-10-4-2-1-3-9(10)13-8-16-12(5-6-12)11(13)7-17-15-13/h1-4,11,15H,5-8H2/t11-,13-/m1/s1 |
| InChIKey | LUCCJGGSDUWENO-DGCLKSJQSA-N |
| XLogP | 1.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |