C11H11BrFN — CID 150644422
(1S,5R)-1-(5-bromo-2-fluorophenyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 150644422) has the molecular formula C11H11BrFN and a molecular weight of 256.12 g/mol. Its IUPAC name is (1S,5R)-1-(5-bromo-2-fluorophenyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-1-(5-bromo-2-fluorophenyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 150644422 |
| Molecular Formula | C11H11BrFN |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | (1S,5R)-1-(5-bromo-2-fluorophenyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | Fc1ccc(Br)cc1[C@@]12CNC[C@@H]1C2 |
| InChI | InChI=1S/C11H11BrFN/c12-8-1-2-10(13)9(3-8)11-4-7(11)5-14-6-11/h1-3,7,14H,4-6H2/t7-,11-/m0/s1 |
| InChIKey | JAOOWRGPUVJTQA-CPCISQLKSA-N |
| XLogP | 2.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |