C12H11BrF3NOS — CID 86650266
5-(5-bromo-2-fluorophenyl)-5-(difluoromethyl)-2-methylmorpholine-3-thione (PubChem CID 86650266) has the molecular formula C12H11BrF3NOS and a molecular weight of 354.19 g/mol. Its IUPAC name is 5-(5-bromo-2-fluorophenyl)-5-(difluoromethyl)-2-methylmorpholine-3-thione.
| Compound Name | 5-(5-bromo-2-fluorophenyl)-5-(difluoromethyl)-2-methylmorpholine-3-thione |
|---|---|
| PubChem CID | 86650266 |
| Molecular Formula | C12H11BrF3NOS |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 5-(5-bromo-2-fluorophenyl)-5-(difluoromethyl)-2-methylmorpholine-3-thione |
| SMILES | CC1OCC(c2cc(Br)ccc2F)(C(F)F)NC1=S |
| InChI | InChI=1S/C12H11BrF3NOS/c1-6-10(19)17-12(5-18-6,11(15)16)8-4-7(13)2-3-9(8)14/h2-4,6,11H,5H2,1H3,(H,17,19) |
| InChIKey | NCDHZDINVLSTOD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|