C12H10BrF4NOS — CID 159833321
(6R)-5-(5-bromo-2-fluorophenyl)-5-methyl-6-(trifluoromethyl)morpholine-3-thione (PubChem CID 159833321) has the molecular formula C12H10BrF4NOS and a molecular weight of 372.18 g/mol. Its IUPAC name is (6R)-5-(5-bromo-2-fluorophenyl)-5-methyl-6-(trifluoromethyl)morpholine-3-thione.
| Compound Name | (6R)-5-(5-bromo-2-fluorophenyl)-5-methyl-6-(trifluoromethyl)morpholine-3-thione |
|---|---|
| PubChem CID | 159833321 |
| Molecular Formula | C12H10BrF4NOS |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | (6R)-5-(5-bromo-2-fluorophenyl)-5-methyl-6-(trifluoromethyl)morpholine-3-thione |
| SMILES | CC1(c2cc(Br)ccc2F)NC(=S)CO[C@H]1C(F)(F)F |
| InChI | InChI=1S/C12H10BrF4NOS/c1-11(7-4-6(13)2-3-8(7)14)10(12(15,16)17)19-5-9(20)18-11/h2-4,10H,5H2,1H3,(H,18,20)/t10-,11?/m1/s1 |
| InChIKey | NNSQJEJUFJPHRA-NFJWQWPMSA-N |
| XLogP | 3.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|