C18H18BrFN2S — CID 123632660
4-(5-bromo-2-fluorophenyl)-4-cyclopropyl-5,6,7,9-tetrahydropyrazolo[1,5-a]azocine-8-thione (PubChem CID 123632660) has the molecular formula C18H18BrFN2S and a molecular weight of 393.33 g/mol. Its IUPAC name is 4-(5-bromo-2-fluorophenyl)-4-cyclopropyl-5,6,7,9-tetrahydropyrazolo[1,5-a]azocine-8-thione.
| Compound Name | 4-(5-bromo-2-fluorophenyl)-4-cyclopropyl-5,6,7,9-tetrahydropyrazolo[1,5-a]azocine-8-thione |
|---|---|
| PubChem CID | 123632660 |
| Molecular Formula | C18H18BrFN2S |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 4-(5-bromo-2-fluorophenyl)-4-cyclopropyl-5,6,7,9-tetrahydropyrazolo[1,5-a]azocine-8-thione |
| SMILES | Fc1ccc(Br)cc1C1(C2CC2)CCCC(=S)Cn2nccc21 |
| InChI | InChI=1S/C18H18BrFN2S/c19-13-5-6-16(20)15(10-13)18(12-3-4-12)8-1-2-14(23)11-22-17(18)7-9-21-22/h5-7,9-10,12H,1-4,8,11H2 |
| InChIKey | JMTFYAFOJCOMMY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|