C13H16BrFN2O4S — CID 175276696
6-(5-bromo-2-fluorophenyl)-5-formyl-4,6-dimethylpiperazine-2-sulfonic acid (PubChem CID 175276696) has the molecular formula C13H16BrFN2O4S and a molecular weight of 395.25 g/mol. Its IUPAC name is 6-(5-bromo-2-fluorophenyl)-5-formyl-4,6-dimethylpiperazine-2-sulfonic acid.
| Compound Name | 6-(5-bromo-2-fluorophenyl)-5-formyl-4,6-dimethylpiperazine-2-sulfonic acid |
|---|---|
| PubChem CID | 175276696 |
| Molecular Formula | C13H16BrFN2O4S |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 6-(5-bromo-2-fluorophenyl)-5-formyl-4,6-dimethylpiperazine-2-sulfonic acid |
| SMILES | CN1CC(S(=O)(=O)O)NC(C)(c2cc(Br)ccc2F)C1C=O |
| InChI | InChI=1S/C13H16BrFN2O4S/c1-13(9-5-8(14)3-4-10(9)15)11(7-18)17(2)6-12(16-13)22(19,20)21/h3-5,7,11-12,16H,6H2,1-2H3,(H,19,20,21) |
| InChIKey | ZNWHYVHQQXYOPG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|