C11H14ClFN2OS — CID 86667993
(5R)-5-(5-amino-2-fluorophenyl)-5-methylmorpholine-3-thione;hydrochloride (PubChem CID 86667993) has the molecular formula C11H14ClFN2OS and a molecular weight of 276.76 g/mol. Its IUPAC name is (5R)-5-(5-amino-2-fluorophenyl)-5-methylmorpholine-3-thione;hydrochloride.
| Compound Name | (5R)-5-(5-amino-2-fluorophenyl)-5-methylmorpholine-3-thione;hydrochloride |
|---|---|
| PubChem CID | 86667993 |
| Molecular Formula | C11H14ClFN2OS |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | (5R)-5-(5-amino-2-fluorophenyl)-5-methylmorpholine-3-thione;hydrochloride |
| SMILES | C[C@@]1(c2cc(N)ccc2F)COCC(=S)N1.Cl |
| InChI | InChI=1S/C11H13FN2OS.ClH/c1-11(6-15-5-10(16)14-11)8-4-7(13)2-3-9(8)12;/h2-4H,5-6,13H2,1H3,(H,14,16);1H/t11-;/m0./s1 |
| InChIKey | XIKQMVUFLOLGOY-MERQFXBCSA-N |
| XLogP | 1.99 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|