C12H12BrF4NO2 — CID 142379078
[4-amino-4-(5-bromo-2-fluorophenyl)-2-(trifluoromethyl)oxolan-3-yl]methanol (PubChem CID 142379078) has the molecular formula C12H12BrF4NO2 and a molecular weight of 358.13 g/mol. Its IUPAC name is [4-amino-4-(5-bromo-2-fluorophenyl)-2-(trifluoromethyl)oxolan-3-yl]methanol.
| Compound Name | [4-amino-4-(5-bromo-2-fluorophenyl)-2-(trifluoromethyl)oxolan-3-yl]methanol |
|---|---|
| PubChem CID | 142379078 |
| Molecular Formula | C12H12BrF4NO2 |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | [4-amino-4-(5-bromo-2-fluorophenyl)-2-(trifluoromethyl)oxolan-3-yl]methanol |
| SMILES | NC1(c2cc(Br)ccc2F)COC(C(F)(F)F)C1CO |
| InChI | InChI=1S/C12H12BrF4NO2/c13-6-1-2-9(14)7(3-6)11(18)5-20-10(8(11)4-19)12(15,16)17/h1-3,8,10,19H,4-5,18H2 |
| InChIKey | PKTPYVOFNCNGQO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |