C18H17BrFNO2 — CID 66931472
(2S,5R)-2-benzyl-5-(5-bromo-2-fluorophenyl)-5-methylmorpholin-3-one (PubChem CID 66931472) has the molecular formula C18H17BrFNO2 and a molecular weight of 378.24 g/mol. Its IUPAC name is (2S,5R)-2-benzyl-5-(5-bromo-2-fluorophenyl)-5-methylmorpholin-3-one.
| Compound Name | (2S,5R)-2-benzyl-5-(5-bromo-2-fluorophenyl)-5-methylmorpholin-3-one |
|---|---|
| PubChem CID | 66931472 |
| Molecular Formula | C18H17BrFNO2 |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (2S,5R)-2-benzyl-5-(5-bromo-2-fluorophenyl)-5-methylmorpholin-3-one |
| SMILES | C[C@@]1(c2cc(Br)ccc2F)CO[C@@H](Cc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C18H17BrFNO2/c1-18(14-10-13(19)7-8-15(14)20)11-23-16(17(22)21-18)9-12-5-3-2-4-6-12/h2-8,10,16H,9,11H2,1H3,(H,21,22)/t16-,18-/m0/s1 |
| InChIKey | LAHAWTWXSBPBGP-WMZOPIPTSA-N |
| XLogP | 3.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |