C12H13FO — CID 105446072
2-ethyl-2-(2-fluorophenyl)cyclopropane-1-carbaldehyde (PubChem CID 105446072) has the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. Its IUPAC name is 2-ethyl-2-(2-fluorophenyl)cyclopropane-1-carbaldehyde.
| Compound Name | 2-ethyl-2-(2-fluorophenyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 105446072 |
| Molecular Formula | C12H13FO |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-ethyl-2-(2-fluorophenyl)cyclopropane-1-carbaldehyde |
| SMILES | CCC1(c2ccccc2F)CC1C=O |
| InChI | InChI=1S/C12H13FO/c1-2-12(7-9(12)8-14)10-5-3-4-6-11(10)13/h3-6,8-9H,2,7H2,1H3 |
| InChIKey | RBTHAZRMYJQZRT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|