C14H16F3NO — CID 174890713
(6S)-3-fluoro-3-(fluoromethyl)-6-(2-fluorophenyl)-6-methylpiperidine-2-carbaldehyde (PubChem CID 174890713) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is (6S)-3-fluoro-3-(fluoromethyl)-6-(2-fluorophenyl)-6-methylpiperidine-2-carbaldehyde.
| Compound Name | (6S)-3-fluoro-3-(fluoromethyl)-6-(2-fluorophenyl)-6-methylpiperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174890713 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (6S)-3-fluoro-3-(fluoromethyl)-6-(2-fluorophenyl)-6-methylpiperidine-2-carbaldehyde |
| SMILES | C[C@@]1(c2ccccc2F)CCC(F)(CF)C(C=O)N1 |
| InChI | InChI=1S/C14H16F3NO/c1-13(10-4-2-3-5-11(10)16)6-7-14(17,9-15)12(8-19)18-13/h2-5,8,12,18H,6-7,9H2,1H3/t12?,13-,14?/m0/s1 |
| InChIKey | NRZMUCUGQQDBQI-MOKVOYLWSA-N |
| XLogP | 2.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|