C11H12FNO — CID 110477207
N-[[1-(2-fluorophenyl)cyclopropyl]methyl]formamide (PubChem CID 110477207) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is N-[[1-(2-fluorophenyl)cyclopropyl]methyl]formamide.
| Compound Name | N-[[1-(2-fluorophenyl)cyclopropyl]methyl]formamide |
|---|---|
| PubChem CID | 110477207 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-[[1-(2-fluorophenyl)cyclopropyl]methyl]formamide |
| SMILES | O=CNCC1(c2ccccc2F)CC1 |
| InChI | InChI=1S/C11H12FNO/c12-10-4-2-1-3-9(10)11(5-6-11)7-13-8-14/h1-4,8H,5-7H2,(H,13,14) |
| InChIKey | UQDVYTNBWAVUGN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|