2-[1-(2-fluorophenyl)cyclopropyl]acetic acid

C11H11FO2 — CID 82075914

IUPAC2-[1-(2-fluorophenyl)cyclopropyl]acetic acid
SMILESO=C(O)CC1(c2ccccc2F)CC1
InChIInChI=1S/C11H11FO2/c12-9-4-2-1-3-8(9)11(5-6-11)7-10(13)14/h1-4H,5-7H2,(H,13,14)
InChIKeyBYRMXDOGVHAACJ-UHFFFAOYSA-N
MW194.21 g/mol
LogP2.33
Rot. Bonds3

About 2-[1-(2-fluorophenyl)cyclopropyl]acetic acid

2-[1-(2-fluorophenyl)cyclopropyl]acetic acid (PubChem CID 82075914) has the molecular formula C11H11FO2 and a molecular weight of 194.21 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)cyclopropyl]acetic acid.

Molecular Properties

Compound Name2-[1-(2-fluorophenyl)cyclopropyl]acetic acid
PubChem CID82075914
Molecular FormulaC11H11FO2
Molecular Weight194.21 g/mol
Exact Mass194.07
IUPAC Name2-[1-(2-fluorophenyl)cyclopropyl]acetic acid
SMILESO=C(O)CC1(c2ccccc2F)CC1
InChIInChI=1S/C11H11FO2/c12-9-4-2-1-3-8(9)11(5-6-11)7-10(13)14/h1-4H,5-7H2,(H,13,14)
InChIKeyBYRMXDOGVHAACJ-UHFFFAOYSA-N
XLogP2.33
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.21
LogP ≤ 52.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-[1-(2-fluorophenyl)cyclopropyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[4-(2-fluorophenyl)-1,1-dioxothian-4-yl]acetic acid
CID 171318653
2-[1-[2-(difluoromethyl)phenyl]cyclopropyl]acetic acid
CID 84790886
4-[[1-(2-fluorophenyl)cyclopropyl]methylamino]-4-oxobutanoic acid
CID 110481809
2-[1-[2-(2-hydroxypropan-2-yl)phenyl]cyclopropyl]acetic acid
CID 117107629
2-[1-(2,3-dimethylphenyl)cyclopropyl]acetic acid
CID 84777910
2-[1-(2-fluoro-3-methoxyphenyl)cyclopropyl]acetic acid
CID 84789631
2-[1-(2-methylphenyl)cyclobutyl]acetic acid
CID 83687028
2-[1-[2-(methoxymethyl)phenyl]cyclopropyl]acetic acid
CID 84787394
2-[1-[2-(diethylamino)phenyl]cyclopropyl]acetic acid
CID 117371219
2-[1-(2,3,6-trifluorophenyl)cyclopropyl]acetic acid
CID 117331938
2-[1-(2-cyclopropylsulfanylphenyl)cyclopropyl]acetic acid
CID 117374314
2-[1-(4-fluoro-2,5-dimethylphenyl)cyclopropyl]acetic acid
CID 84788583

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2-fluorophenyl)cyclopropyl]acetic acid?
The IUPAC name of 2-[1-(2-fluorophenyl)cyclopropyl]acetic acid (CID 82075914) is 2-[1-(2-fluorophenyl)cyclopropyl]acetic acid.
What is the SMILES notation for 2-[1-(2-fluorophenyl)cyclopropyl]acetic acid?
The canonical SMILES for 2-[1-(2-fluorophenyl)cyclopropyl]acetic acid is O=C(O)CC1(c2ccccc2F)CC1.
What is the InChIKey of 2-[1-(2-fluorophenyl)cyclopropyl]acetic acid?
The InChIKey is BYRMXDOGVHAACJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FO2/c12-9-4-2-1-3-8(9)11(5-6-11)7-10(13)14/h1-4H,5-7H2,(H,13,14).
What are the key properties of 2-[1-(2-fluorophenyl)cyclopropyl]acetic acid?
2-[1-(2-fluorophenyl)cyclopropyl]acetic acid has a molecular weight of 194.21 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-fluorophenyl)cyclopropyl]acetic acid is sourced from PubChem (CID 82075914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).