C13H15FO4S — CID 171318653
2-[4-(2-fluorophenyl)-1,1-dioxothian-4-yl]acetic acid (PubChem CID 171318653) has the molecular formula C13H15FO4S and a molecular weight of 286.32 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)-1,1-dioxothian-4-yl]acetic acid.
| Compound Name | 2-[4-(2-fluorophenyl)-1,1-dioxothian-4-yl]acetic acid |
|---|---|
| PubChem CID | 171318653 |
| Molecular Formula | C13H15FO4S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-[4-(2-fluorophenyl)-1,1-dioxothian-4-yl]acetic acid |
| SMILES | O=C(O)CC1(c2ccccc2F)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H15FO4S/c14-11-4-2-1-3-10(11)13(9-12(15)16)5-7-19(17,18)8-6-13/h1-4H,5-9H2,(H,15,16) |
| InChIKey | PDPLMKQMCLRQAD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |