C14H16FNO3 — CID 110481809
4-[[1-(2-fluorophenyl)cyclopropyl]methylamino]-4-oxobutanoic acid (PubChem CID 110481809) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is 4-[[1-(2-fluorophenyl)cyclopropyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[1-(2-fluorophenyl)cyclopropyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 110481809 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-[[1-(2-fluorophenyl)cyclopropyl]methylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCC1(c2ccccc2F)CC1 |
| InChI | InChI=1S/C14H16FNO3/c15-11-4-2-1-3-10(11)14(7-8-14)9-16-12(17)5-6-13(18)19/h1-4H,5-9H2,(H,16,17)(H,18,19) |
| InChIKey | LIWUIVQGXMBZDN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |