C13H16O2 — CID 83687028
2-[1-(2-methylphenyl)cyclobutyl]acetic acid (PubChem CID 83687028) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[1-(2-methylphenyl)cyclobutyl]acetic acid.
| Compound Name | 2-[1-(2-methylphenyl)cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 83687028 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-[1-(2-methylphenyl)cyclobutyl]acetic acid |
| SMILES | Cc1ccccc1C1(CC(=O)O)CCC1 |
| InChI | InChI=1S/C13H16O2/c1-10-5-2-3-6-11(10)13(7-4-8-13)9-12(14)15/h2-3,5-6H,4,7-9H2,1H3,(H,14,15) |
| InChIKey | RJOWUEZFHAZSIK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |