About 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid
2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid (PubChem CID 117332749) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid.
Molecular Properties
| Compound Name | 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid |
| PubChem CID | 117332749 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid |
| SMILES | Cc1ccc(C2(CC(=O)O)CC2)c2c1CCC2 |
| InChI | InChI=1S/C15H18O2/c1-10-5-6-13(12-4-2-3-11(10)12)15(7-8-15)9-14(16)17/h5-6H,2-4,7-9H2,1H3,(H,16,17) |
| InChIKey | AZSSOOJMMOONJA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid?
The IUPAC name of 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid (CID 117332749) is 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid.
What is the SMILES notation for 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid?
The canonical SMILES for 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid is Cc1ccc(C2(CC(=O)O)CC2)c2c1CCC2.
What is the InChIKey of 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid?
The InChIKey is AZSSOOJMMOONJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O2/c1-10-5-6-13(12-4-2-3-11(10)12)15(7-8-15)9-14(16)17/h5-6H,2-4,7-9H2,1H3,(H,16,17).
What are the key properties of 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid?
2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid has a molecular weight of 230.31 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(7-methyl-2,3-dihydro-1H-inden-4-yl)cyclopropyl]acetic acid is sourced from PubChem (CID 117332749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).